EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C20H24N2O2.HCl |
| Net Charge | 0 |
| Average Mass | 397.346 |
| Monoisotopic Mass | 396.13713 |
| SMILES | Cl.Cl.[H][C@]1(C=C)CN2CC[C@H]1C[C@@]2([H])[C@]([H])(O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C20H24N2O2.2ClH/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;;/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;2*1H/t13-,14-,19-,20+;;/m0../s1 |
| InChIKey | NNKXWRRDHYTHFP-HZQSTTLBSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quinine dihydrochloride (CHEBI:754785) is a cinchona alkaloid (CHEBI:51323) |
| Synonyms | Source |
|---|---|
| Acid quinine hydrochloride | ChEMBL |
| Neutral quinine hydrochloride | ChEMBL |
| Quinine bimuriate | ChEMBL |
| Quinine dihydrochloride | ChEMBL |
| Quinini dihydrochloridum | ChEMBL |