EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C22H23ClN2O8 |
| Net Charge | 0 |
| Average Mass | 515.346 |
| Monoisotopic Mass | 514.09097 |
| SMILES | Cl.[H][C@]12C[C@@]3([H])[C@H](N(C)C)C(O)=C(C(N)=O)C(=O)[C@@]3(O)C(O)=C1C(=O)c1c(O)ccc(Cl)c1[C@@]2(C)O |
| InChI | InChI=1S/C22H23ClN2O8.ClH/c1-21(32)7-6-8-15(25(2)3)17(28)13(20(24)31)19(30)22(8,33)18(29)11(7)16(27)12-10(26)5-4-9(23)14(12)21;/h4-5,7-8,15,26,28-29,32-33H,6H2,1-3H3,(H2,24,31);1H/t7-,8-,15-,21-,22-;/m0./s1 |
| InChIKey | CBHYYLPALVVVEY-MRFRVZCGSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlortetracycline hydrochloride (CHEBI:754780) is a tetracyclines (CHEBI:26895) |
| Synonyms | Source |
|---|---|
| Aureomycin monohydrochloride | ChEMBL |
| Chlortetracyclini hydrochloridum | ChEMBL |
| Isphamycin | ChEMBL |
| NSC-13252 | ChEMBL |
| Brand Names | Source |
|---|---|
| Aureomycin | ChEMBL |
| Chlortet hcl | ChEMBL |
| Isaphamycin | ChEMBL |
| Citations |
|---|