EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H24F4N6O |
| Net Charge | 0 |
| Average Mass | 512.511 |
| Monoisotopic Mass | 512.19477 |
| SMILES | CN(C(=O)c1ccc(F)cc1C(F)(F)F)C1CCN(c2nnc(-c3ccnn3C)c3ccccc23)CC1 |
| InChI | InChI=1S/C26H24F4N6O/c1-34(25(37)20-8-7-16(27)15-21(20)26(28,29)30)17-10-13-36(14-11-17)24-19-6-4-3-5-18(19)23(32-33-24)22-9-12-31-35(22)2/h3-9,12,15,17H,10-11,13-14H2,1-2H3 |
| InChIKey | SZBGQDXLNMELTB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antifibrotic agent Any agent which acts to reduce fibrosis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| taladegib (CHEBI:754776) has role antifibrotic agent (CHEBI:233423) |
| taladegib (CHEBI:754776) has role antineoplastic agent (CHEBI:35610) |
| taladegib (CHEBI:754776) is a phthalazines (CHEBI:38768) |
| INN | Source |
|---|---|
| taladegib | WHO MedNet |
| Synonyms | Source |
|---|---|
| LY-2940680 | ChEMBL |
| LY2940680 | ChEMBL |
| Citations |
|---|