EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:754773 - frovatriptan succinate
| Formula | H2O.C14H17N3O.C4H6O4 |
| Net Charge | 0 |
| Average Mass | 379.413 |
| Monoisotopic Mass | 379.17434 |
| SMILES | CN[C@@H]1CCc2nc3ccc(C(N)=O)cc3c2C1.O.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C14H17N3O.C4H6O4.H2O/c1-16-9-3-5-13-11(7-9)10-6-8(14(15)18)2-4-12(10)17-13;5-3(6)1-2-4(7)8;/h2,4,6,9,16-17H,3,5,7H2,1H3,(H2,15,18);1-2H2,(H,5,6)(H,7,8);1H2/t9-;;/m1../s1 |
| InChIKey | CUETXFMONOSVJA-KLQYNRQASA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| frovatriptan succinate (CHEBI:754773) is a carbazoles (CHEBI:48513) |
| Synonyms | Source |
|---|---|
| Frovatriptan succinate monohydrate | ChEMBL |
| Frovelan | ChEMBL |
| Miguard | ChEMBL |
| NSC-760422 | ChEMBL |
| SB 209509 AX | ChEMBL |
| SB 209509-AX | ChEMBL |
| Brand Name | Source |
|---|---|
| Frova | ChEMBL |