EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26ClNO3S |
| Net Charge | 0 |
| Average Mass | 443.996 |
| Monoisotopic Mass | 443.13219 |
| SMILES | NC(CO)(CO)CCc1ccc(Sc2cccc(OCc3ccccc3)c2)cc1Cl |
| InChI | InChI=1S/C24H26ClNO3S/c25-23-14-22(10-9-19(23)11-12-24(26,16-27)17-28)30-21-8-4-7-20(13-21)29-15-18-5-2-1-3-6-18/h1-10,13-14,27-28H,11-12,15-17,26H2 |
| InChIKey | IINUNQPYJGJCJI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mocravimod (CHEBI:754771) has role anti-inflammatory agent (CHEBI:67079) |
| mocravimod (CHEBI:754771) has role antineoplastic agent (CHEBI:35610) |
| mocravimod (CHEBI:754771) is a aryl sulfide (CHEBI:35683) |
| Synonyms | Source |
|---|---|
| KRP-203 | ChEMBL |
| KRP203 | ChEMBL |
| Mocravimod | ChEMBL |