EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25NO4 |
| Net Charge | 0 |
| Average Mass | 355.434 |
| Monoisotopic Mass | 355.17836 |
| SMILES | [H][C@@]12Oc3c(O)ccc4c3[C@@]13CCN(CC=C(C)C)[C@]([H])(C4)[C@]3(O)CCC2=O |
| InChI | InChI=1S/C21H25NO4/c1-12(2)6-9-22-10-8-20-17-13-3-4-14(23)18(17)26-19(20)15(24)5-7-21(20,25)16(22)11-13/h3-4,6,16,19,23,25H,5,7-11H2,1-2H3/t16-,19+,20+,21-/m1/s1 |
| InChIKey | OHKCLOQPSLQCQR-MBPVOVBZSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nalmexone (CHEBI:754747) is a phenanthrenes (CHEBI:25961) |
| INNs | Source |
|---|---|
| nalmexona | WHO MedNet |
| nalmexone | WHO MedNet |
| Citations |
|---|