EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26N2 |
| Net Charge | 0 |
| Average Mass | 294.442 |
| Monoisotopic Mass | 294.20960 |
| SMILES | [H][C@@]12CCCC[C@@]1([H])C[C@@]1([H])c3c(c4ccccc4n3C)CCN1C2 |
| InChI | InChI=1S/C20H26N2/c1-21-18-9-5-4-8-16(18)17-10-11-22-13-15-7-3-2-6-14(15)12-19(22)20(17)21/h4-5,8-9,14-15,19H,2-3,6-7,10-13H2,1H3/t14-,15-,19-/m0/s1 |
| InChIKey | SNMPZBCEJSLAEK-DOXZYTNZSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mimbane (CHEBI:754638) is a alkaloid (CHEBI:22315) |
| INNs | Source |
|---|---|
| mimbane | WHO MedNet |
| mimbrano | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-methylyohimbane | ChEMBL |
| NSC-76808 | ChEMBL |