EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34O6 |
| Net Charge | 0 |
| Average Mass | 418.530 |
| Monoisotopic Mass | 418.23554 |
| SMILES | [H][C@]12CC[C@]3(C)[C@](O)(CCC(=O)O)CC[C@@]3([H])[C@]1([H])[C@H](C(=O)OC)CC1=CC(=O)CC[C@@]12C |
| InChI | InChI=1S/C24H34O6/c1-22-8-4-15(25)12-14(22)13-16(21(28)30-3)20-17(22)5-9-23(2)18(20)6-10-24(23,29)11-7-19(26)27/h12,16-18,20,29H,4-11,13H2,1-3H3,(H,26,27)/t16-,17+,18+,20-,22+,23+,24-/m1/s1 |
| InChIKey | JBXXREPMUABISH-RGKMBJPFSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mexrenoate (CHEBI:754633) has role androgen (CHEBI:50113) |
| mexrenoate (CHEBI:754633) is a 3-hydroxy steroid (CHEBI:36834) |