EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H10O2 |
| Net Charge | 0 |
| Average Mass | 90.122 |
| Monoisotopic Mass | 90.06808 |
| SMILES | C[C@H](O)[C@@H](C)O |
| InChI | InChI=1S/C4H10O2/c1-3(5)4(2)6/h3-6H,1-2H3/t3-,4+ |
| InChIKey | OWBTYPJTUOEWEK-ZXZARUISSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| meso-butane-2,3-diol (CHEBI:75460) has role metabolite (CHEBI:25212) |
| meso-butane-2,3-diol (CHEBI:75460) is a butane-2,3-diol (CHEBI:62064) |
| IUPAC Name |
|---|
| (2R,3S)-butane-2,3-diol |
| Synonyms | Source |
|---|---|
| (2RS,3SR)-2,3-butanediol | ChEBI |
| (2RS,3SR)-butane-2,3-diol | ChEBI |
| (2S,3R)-2,3-butananediol | ChEBI |
| (2S,3R)-butanane-2,3-diol | ChEBI |
| erythro-2,3-butanediol | ChEBI |
| erythro-butane-2,3-diol | ChEBI |
| UniProt Name | Source |
|---|---|
| (R,S)-butane-2,3-diol | UniProt |
| Citations |
|---|