EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H5F3N4O |
| Net Charge | 0 |
| Average Mass | 254.171 |
| Monoisotopic Mass | 254.04155 |
| SMILES | N#CC(C#N)=NNc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C10H5F3N4O/c11-10(12,13)18-9-3-1-7(2-4-9)16-17-8(5-14)6-15/h1-4,16H |
| InChIKey | BMZRVOVNUMQTIN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | ATP synthase inhibitor A mitochondrial respiratory-chain inhibitor that interferes with the action of ATP synthase. ionophore A compound which can carry specific ions through membranes of cells or organelles. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carbonyl cyanide p-trifluoromethoxyphenylhydrazone (CHEBI:75458) has functional parent hydrazonomalononitrile (CHEBI:33189) |
| carbonyl cyanide p-trifluoromethoxyphenylhydrazone (CHEBI:75458) has role ATP synthase inhibitor (CHEBI:20854) |
| carbonyl cyanide p-trifluoromethoxyphenylhydrazone (CHEBI:75458) has role geroprotector (CHEBI:176497) |
| carbonyl cyanide p-trifluoromethoxyphenylhydrazone (CHEBI:75458) has role ionophore (CHEBI:24869) |
| carbonyl cyanide p-trifluoromethoxyphenylhydrazone (CHEBI:75458) is a aromatic ether (CHEBI:35618) |
| carbonyl cyanide p-trifluoromethoxyphenylhydrazone (CHEBI:75458) is a hydrazone (CHEBI:38532) |
| carbonyl cyanide p-trifluoromethoxyphenylhydrazone (CHEBI:75458) is a nitrile (CHEBI:18379) |
| carbonyl cyanide p-trifluoromethoxyphenylhydrazone (CHEBI:75458) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| {[4-(trifluoromethoxy)phenyl]hydrazono}malononitrile |
| Synonyms | Source |
|---|---|
| FCCP | ChemIDplus |
| Carbonyl cyanide 4-trifluoromethoxyphenylhydrazone | ChemIDplus |
| carbonylcyanide-p-trifluoromethoxyphenylhydrazone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| US2002045621 | Patent |
| WO2007016419 | Patent |
| CPD-10715 | MetaCyc |
| Carbonyl_cyanide-p-trifluoromethoxyphenylhydrazone | Wikipedia |
| LSM-2317 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4693268 | Reaxys |
| CAS:370-86-5 | ChemIDplus |
| Citations |
|---|