EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15N3O7 |
| Net Charge | 0 |
| Average Mass | 313.266 |
| Monoisotopic Mass | 313.09100 |
| SMILES | O=C(N/N=C/[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(=O)O)c1ccncc1 |
| InChI | InChI=1S/C12H15N3O7/c16-7(8(17)9(18)10(19)12(21)22)5-14-15-11(20)6-1-3-13-4-2-6/h1-5,7-10,16-19H,(H,15,20)(H,21,22)/b14-5+/t7-,8+,9-,10-/m0/s1 |
| InChIKey | WREFPPXAWHSISP-PBJGZRIOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoniazid glucuronate (CHEBI:754552) is a aromatic carboxylic acid (CHEBI:33859) |
| isoniazid glucuronate (CHEBI:754552) is a pyridinemonocarboxylic acid (CHEBI:26420) |