EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H38O4 |
| Net Charge | 0 |
| Average Mass | 330.509 |
| Monoisotopic Mass | 330.27701 |
| SMILES | CCCCCCCCCCCCCCCC(=O)OC(CO)CO |
| InChI | InChI=1S/C19H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(22)23-18(16-20)17-21/h18,20-21H,2-17H2,1H3 |
| InChIKey | BBNYCLAREVXOSG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) |
| Roles Classification |
|---|
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-palmitoylglycerol (CHEBI:75455) has functional parent hexadecanoic acid (CHEBI:15756) |
| 2-palmitoylglycerol (CHEBI:75455) has role algal metabolite (CHEBI:84735) |
| 2-palmitoylglycerol (CHEBI:75455) is a 2-acylglycerol 16:0 (CHEBI:134138) |
| IUPAC Name |
|---|
| 1,3-dihydroxypropan-2-yl hexadecanoate |
| Synonyms | Source |
|---|---|
| MG (0:0/16:0/0:0) | SUBMITTER |
| 2-monopalmitoylglycerol | ChEBI |
| 1,3-dihydroxypropan-2-yl palmitate | ChEBI |
| 2-O-palmitoylglycerol | ChEBI |
| 2-monopalmitin | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-hexadecanoylglycerol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| LMGL01010025 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1796692 | Reaxys |