EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:754519 - ciladopa
| Formula | C21H26N2O4 |
| Net Charge | 0 |
| Average Mass | 370.449 |
| Monoisotopic Mass | 370.18926 |
| SMILES | COc1ccc([C@H](O)CN2CCN(c3cccccc3=O)CC2)cc1OC |
| InChI | InChI=1S/C21H26N2O4/c1-26-20-9-8-16(14-21(20)27-2)19(25)15-22-10-12-23(13-11-22)17-6-4-3-5-7-18(17)24/h3-9,14,19,25H,10-13,15H2,1-2H3/t19-/m1/s1 |
| InChIKey | SGEKLKJQLHJVDK-LJQANCHMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ciladopa (CHEBI:754519) is a N-arylpiperazine (CHEBI:46848) |
| Synonyms | Source |
|---|---|
| AY-27110 FREE BASE | ChEMBL |
| Ciladopa | ChEMBL |
| Citations |
|---|