EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:754495 - pomaglumetad methionil anhydrous
| Formula | C12H18N2O7S2 |
| Net Charge | 0 |
| Average Mass | 366.417 |
| Monoisotopic Mass | 366.05554 |
| SMILES | [H][C@@]12[C@@H](C(=O)O)[C@]1([H])S(=O)(=O)C[C@@]2(NC(=O)[C@@H](N)CCSC)C(=O)O |
| InChI | InChI=1S/C12H18N2O7S2/c1-22-3-2-5(13)9(15)14-12(11(18)19)4-23(20,21)8-6(7(8)12)10(16)17/h5-8H,2-4,13H2,1H3,(H,14,15)(H,16,17)(H,18,19)/t5-,6+,7+,8-,12-/m0/s1 |
| InChIKey | VOYCNOJFAJAILW-CAMHOICYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pomaglumetad methionil anhydrous (CHEBI:754495) has role antidepressant (CHEBI:35469) |
| pomaglumetad methionil anhydrous (CHEBI:754495) has role antipsychotic agent (CHEBI:35476) |
| pomaglumetad methionil anhydrous (CHEBI:754495) is a dipeptide (CHEBI:46761) |
| Synonyms | Source |
|---|---|
| LY-2140023 | ChEMBL |
| LY2140023 | ChEMBL |
| Pomaglumetad methionil anhydrous | ChEMBL |