EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19N5O6S2 |
| Net Charge | 0 |
| Average Mass | 453.502 |
| Monoisotopic Mass | 453.07768 |
| SMILES | [H][C@]12SCC([C@@H]3CCCO3)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)/C(=N/OC)c1csc(N)n1 |
| InChI | InChI=1S/C17H19N5O6S2/c1-27-21-10(8-6-30-17(18)19-8)13(23)20-11-14(24)22-12(16(25)26)7(5-29-15(11)22)9-3-2-4-28-9/h6,9,11,15H,2-5H2,1H3,(H2,18,19)(H,20,23)(H,25,26)/b21-10+/t9-,11+,15+/m0/s1 |
| InChIKey | ZJGQFXVQDVCVOK-MSUXKOGISA-N |
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefovecin (CHEBI:754438) is a cephalosporin (CHEBI:23066) |
| INNs | Source |
|---|---|
| cefovecin | WHO MedNet |
| cefovecina | WHO MedNet |
| cefovecine | WHO MedNet |
| Synonyms | Source |
|---|---|
| Cefovecin (ema epar: veterinary) | ChEMBL |
| Convenia | ChEMBL |