EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H35N3O6S |
| Net Charge | 0 |
| Average Mass | 529.659 |
| Monoisotopic Mass | 529.22466 |
| SMILES | CCOC(=O)[C@@H](N)CCC(=O)N[C@@H](CSCc1ccccc1)C(=O)N[C@@H](C(=O)OCC)c1ccccc1 |
| InChI | InChI=1S/C27H35N3O6S/c1-3-35-26(33)21(28)15-16-23(31)29-22(18-37-17-19-11-7-5-8-12-19)25(32)30-24(27(34)36-4-2)20-13-9-6-10-14-20/h5-14,21-22,24H,3-4,15-18,28H2,1-2H3,(H,29,31)(H,30,32)/t21-,22-,24+/m0/s1 |
| InChIKey | GWEJFLVSOGNLSS-WPFOTENUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ezatiostat (CHEBI:754420) has role antineoplastic agent (CHEBI:35610) |
| ezatiostat (CHEBI:754420) is a oligopeptide (CHEBI:25676) |
| INN | Source |
|---|---|
| ezatiostat | WHO MedNet |
| Synonym | Source |
|---|---|
| TLK-199 | ChEMBL |