EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C97H124N20O31S |
| Net Charge | 0 |
| Average Mass | 2098.235 |
| Monoisotopic Mass | 2096.84621 |
| SMILES | CSCC[C@H](NC(=O)[C@H](Cc1cnc2ccccc12)NC(=O)CNC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc2ccccc12)NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)[C@@H]1CCC(=O)N1)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C97H124N20O31S/c1-49(2)39-68(114-95(146)71(43-54-46-100-59-18-11-9-16-57(54)59)116-97(148)73-19-12-37-117(73)76(121)48-102-85(136)60-24-30-74(119)104-60)93(144)110-65(29-35-81(130)131)91(142)109-64(28-34-80(128)129)90(141)108-63(27-33-79(126)127)89(140)107-62(26-32-78(124)125)88(139)106-61(25-31-77(122)123)87(138)103-50(3)84(135)113-69(41-52-20-22-55(118)23-21-52)86(137)101-47-75(120)105-70(42-53-45-99-58-17-10-8-15-56(53)58)94(145)111-66(36-38-149-4)92(143)115-72(44-82(132)133)96(147)112-67(83(98)134)40-51-13-6-5-7-14-51/h5-11,13-18,20-23,45-46,49-50,60-73,99-100,118H,12,19,24-44,47-48H2,1-4H3,(H2,98,134)(H,101,137)(H,102,136)(H,103,138)(H,104,119)(H,105,120)(H,106,139)(H,107,140)(H,108,141)(H,109,142)(H,110,144)(H,111,145)(H,112,147)(H,113,135)(H,114,146)(H,115,143)(H,116,148)(H,122,123)(H,124,125)(H,126,127)(H,128,129)(H,130,131)(H,132,133)/t50-,60-,61-,62-,63-,64-,65-,66-,67-,68-,69-,70-,71-,72-,73-/m0/s1 |
| InChIKey | GKDWRERMBNGKCZ-RNXBIMIWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. cholecystokinin antagonist A hormone antagonist that inhibits the action of the peptide hormone cholecystokinin. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. cholecystokinin antagonist A hormone antagonist that inhibits the action of the peptide hormone cholecystokinin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gastrin-17 (CHEBI:75441) has role antineoplastic agent (CHEBI:35610) |
| gastrin-17 (CHEBI:75441) is a gastrin (CHEBI:75436) |
| IUPAC Name |
|---|
| 5-oxo-L-prolylglycyl-L-prolyl-L-tryptophyl-L-leucyl-L-α-glutamyl-L-α-glutamyl-L-α-glutamyl-L-α-glutamyl-L-α-glutamyl-L-alanyl-L-tyrosylglycyl-L-tryptophyl-L-methionyl-L-α-aspartyl-L-phenylalaninamide |
| Synonyms | Source |
|---|---|
| G 17 | ChemIDplus |
| Gastrin heptadecapeptide | ChemIDplus |
| Glp-Gly-Pro-Trp-Leu-Glu-Glu-Glu-Glu-Glu-Ala-Tyr-Gly-Trp-Met-Asp-Phe-NH2 | ChEBI |
| Heptadecapeptide gastrin | KEGG COMPOUND |
| Little gastrin | KEGG COMPOUND |
| Little gastrin I | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C16113 | KEGG COMPOUND |
| CA2698980 | Patent |
| Little_gastrin | Wikipedia |
| WO2009033729 | Patent |
| WO2009039995 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11842134 | Reaxys |
| Reaxys:8188172 | Reaxys |
| CAS:60748-06-3 | ChemIDplus |
| CAS:60748-06-3 | KEGG COMPOUND |
| Citations |
|---|