EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H24N6O4 |
| Net Charge | 0 |
| Average Mass | 340.384 |
| Monoisotopic Mass | 340.18590 |
| SMILES | NCCCC[C@H](NC(=O)[C@H](Cc1cncn1)NC(=O)CN)C(=O)O |
| InChI | InChI=1S/C14H24N6O4/c15-4-2-1-3-10(14(23)24)20-13(22)11(19-12(21)6-16)5-9-7-17-8-18-9/h7-8,10-11H,1-6,15-16H2,(H,17,18)(H,19,21)(H,20,22)(H,23,24)/t10-,11-/m0/s1 |
| InChIKey | MVORZMQFXBLMHM-QWRGUYRKSA-N |
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. vulnerary A drug used in treating and healing of wounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gly-His-Lys (CHEBI:75430) has role chelator (CHEBI:38161) |
| Gly-His-Lys (CHEBI:75430) has role hepatoprotective agent (CHEBI:62868) |
| Gly-His-Lys (CHEBI:75430) has role metabolite (CHEBI:25212) |
| Gly-His-Lys (CHEBI:75430) has role vulnerary (CHEBI:73336) |
| Gly-His-Lys (CHEBI:75430) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| glycyl-L-histidyl-L-lysine |
| Synonyms | Source |
|---|---|
| Gly-L-His-L-Lys | ChEBI |
| glycylhistidyllysine | ChEBI |
| GHK | ChEBI |
| Glycyl-histidyl-lysine | ChemIDplus |
| liver cell growth factor | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:965283 | Reaxys |
| CAS:49557-75-7 | ChemIDplus |
| Citations |
|---|