EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14ClN3O2 |
| Net Charge | 0 |
| Average Mass | 315.760 |
| Monoisotopic Mass | 315.07745 |
| SMILES | COc1cc2ncnc(Nc3cccc(Cl)c3)c2cc1OC |
| InChI | InChI=1S/C16H14ClN3O2/c1-21-14-7-12-13(8-15(14)22-2)18-9-19-16(12)20-11-5-3-4-10(17)6-11/h3-9H,1-2H3,(H,18,19,20) |
| InChIKey | GFNNBHLJANVSQV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | epidermal growth factor receptor antagonist An antagonist at the epidermal growth factor receptor. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tyrphostin AG 1478 (CHEBI:75404) has role antineoplastic agent (CHEBI:35610) |
| tyrphostin AG 1478 (CHEBI:75404) has role antiviral agent (CHEBI:22587) |
| tyrphostin AG 1478 (CHEBI:75404) has role epidermal growth factor receptor antagonist (CHEBI:74440) |
| tyrphostin AG 1478 (CHEBI:75404) has role geroprotector (CHEBI:176497) |
| tyrphostin AG 1478 (CHEBI:75404) is a aromatic ether (CHEBI:35618) |
| tyrphostin AG 1478 (CHEBI:75404) is a monochlorobenzenes (CHEBI:83403) |
| tyrphostin AG 1478 (CHEBI:75404) is a quinazolines (CHEBI:38530) |
| IUPAC Name |
|---|
| N-(3-chlorophenyl)-6,7-dimethoxy-quinazolin-4-amine |
| Synonyms | Source |
|---|---|
| AG 1478 | ChemIDplus |
| AG-1478 | ChemIDplus |
| tyrphostin AG-1478 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7437034 | Reaxys |
| CAS:170449-18-0 | ChemIDplus |
| Citations |
|---|