EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H46O2 |
| Net Charge | 0 |
| Average Mass | 498.751 |
| Monoisotopic Mass | 498.34978 |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C=C(\C)C(=O)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C35H46O2/c1-27(17-11-19-29(3)21-13-22-32(6)34(36)37)15-9-10-16-28(2)18-12-20-30(4)24-25-33-31(5)23-14-26-35(33,7)8/h9-13,15-22,24-25H,14,23,26H2,1-8H3,(H,36,37)/b10-9+,17-11+,18-12+,21-13+,25-24+,27-15+,28-16+,29-19+,30-20+,32-22+ |
| InChIKey | UGJYMKZYSUMAKJ-ZGMBEONKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neurosporaxanthin (CHEBI:7540) is a apo carotenoid C35 terpenoid (CHEBI:53185) |
| neurosporaxanthin (CHEBI:7540) is a monocarboxylic acid (CHEBI:25384) |
| neurosporaxanthin (CHEBI:7540) is conjugate acid of neurosporaxanthin(1−) (CHEBI:63069) |
| Incoming Relation(s) |
| neurosporaxanthin(1−) (CHEBI:63069) is conjugate base of neurosporaxanthin (CHEBI:7540) |
| IUPAC Name |
|---|
| (2E,4E,6E,8E,10E,12E,14E,16E,18E,20E)-2,6,10,15,19-pentamethyl-21-(2,6,6-trimethylcyclohex-1-en-1-yl)henicosa-2,4,6,8,10,12,14,16,18,20-decaenoic acid |
| Synonyms | Source |
|---|---|
| 4'-apo-β,ψ-caroten-4'-oic acid | ChEBI |
| all-trans-2,6,10,15,19-pentamethyl-21-(2,6,6-trimethylcyclohex-1-en-1-yl)henicosa-2,4,6,8,10,12,14,16,18,20-decaenoic acid | ChEBI |
| 4'-apo-β-caroten-4'-oic acid | ChEBI |
| all-trans-neurosporaxanthin | KEGG COMPOUND |
| β-apo-4'-carotenoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C08607 | KEGG COMPOUND |
| CPD-12930 | MetaCyc |
| LMPR01070279 | LIPID MAPS |
| C00003781 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2634134 | Reaxys |
| CAS:2468-88-4 | KEGG COMPOUND |
| Citations |
|---|