EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32O16 |
| Net Charge | 0 |
| Average Mass | 624.548 |
| Monoisotopic Mass | 624.16903 |
| SMILES | COc1cc(-c2cc(=O)c3c(O)cc(O[C@@H]4O[C@H](CO[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@H]4O)cc3o2)ccc1O |
| InChI | InChI=1S/C28H32O16/c1-39-16-4-10(2-3-12(16)30)15-7-14(32)20-13(31)5-11(6-17(20)42-15)41-28-26(38)24(36)22(34)19(44-28)9-40-27-25(37)23(35)21(33)18(8-29)43-27/h2-7,18-19,21-31,33-38H,8-9H2,1H3/t18-,19-,21-,22-,23+,24+,25-,26-,27-,28-/m1/s1 |
| InChIKey | VBQHDIZHOUCBIA-FJUFGMPQSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chrysoeriol 7-O-gentiobioside (CHEBI:75398) has functional parent 4',5,7-trihydroxy-3'-methoxyflavone (CHEBI:16514) |
| chrysoeriol 7-O-gentiobioside (CHEBI:75398) has role metabolite (CHEBI:25212) |
| chrysoeriol 7-O-gentiobioside (CHEBI:75398) is a dihydroxyflavone (CHEBI:38686) |
| chrysoeriol 7-O-gentiobioside (CHEBI:75398) is a disaccharide derivative (CHEBI:63353) |
| chrysoeriol 7-O-gentiobioside (CHEBI:75398) is a gentiobioside (CHEBI:24215) |
| chrysoeriol 7-O-gentiobioside (CHEBI:75398) is a glycosyloxyflavone (CHEBI:50018) |
| chrysoeriol 7-O-gentiobioside (CHEBI:75398) is a monomethoxyflavone (CHEBI:25401) |
| IUPAC Name |
|---|
| 5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxo-4H-chromen-7-yl 6-O-β-D-glucopyranosyl-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| chrysoeriol 7-O-diglucoside | ChEBI |