EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H21N3O |
| Net Charge | 0 |
| Average Mass | 247.342 |
| Monoisotopic Mass | 247.16846 |
| SMILES | [H][C@]1([C@@H](C)N)CC[C@H](C(=O)Nc2ccncc2)CC1 |
| InChI | InChI=1S/C14H21N3O/c1-10(15)11-2-4-12(5-3-11)14(18)17-13-6-8-16-9-7-13/h6-12H,2-5,15H2,1H3,(H,16,17,18)/t10-,11-,12-/m1/s1 |
| InChIKey | IYOZTVGMEWJPKR-IJLUTSLNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Y-27632 (CHEBI:75393) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| Y-27632 (CHEBI:75393) is a monocarboxylic acid amide (CHEBI:29347) |
| Y-27632 (CHEBI:75393) is a primary amino compound (CHEBI:50994) |
| Y-27632 (CHEBI:75393) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| trans-4-[(1R)-1-aminoethyl]-N-(pyridin-4-yl)cyclohexanecarboxamide |
| Synonyms | Source |
|---|---|
| 4-[(1R)-1-aminoethyl]-N-(pyridin-4-yl)cyclohexane-1-carboxamide | IUPHAR |
| (R)-(+)-trans-N-(4-pyridyl)-4-(1-aminoethyl)-cyclohexanecarboxamide | ChEBI |
| Y 27632 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9134889 | Reaxys |
| CAS:146986-50-7 | ChemIDplus |
| Citations |
|---|