EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H14N4S2 |
| Net Charge | 0 |
| Average Mass | 350.472 |
| Monoisotopic Mass | 350.06599 |
| SMILES | N#CC(=C(/N)Sc1ccccc1)/C(C#N)=C(\N)Sc1ccccc1 |
| InChI | InChI=1S/C18H14N4S2/c19-11-15(17(21)23-13-7-3-1-4-8-13)16(12-20)18(22)24-14-9-5-2-6-10-14/h1-10H,21-22H2/b17-15+,18-16+ |
| InChIKey | BDLRGKKVJJEYLC-YTEMWHBBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | protein kinase inhibitor An EC 2.7.* (P-containing group transferase) inhibitor that interferes with the action of protein kinases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,4-diamino-2,3-dicyano-1,4-bis(phenylthio)butadiene (CHEBI:75389) has parent hydride buta-1,3-diene (CHEBI:39478) |
| 1,4-diamino-2,3-dicyano-1,4-bis(phenylthio)butadiene (CHEBI:75389) has role protein kinase inhibitor (CHEBI:37699) |
| 1,4-diamino-2,3-dicyano-1,4-bis(phenylthio)butadiene (CHEBI:75389) is a aryl sulfide (CHEBI:35683) |
| 1,4-diamino-2,3-dicyano-1,4-bis(phenylthio)butadiene (CHEBI:75389) is a dinitrile (CHEBI:51308) |
| 1,4-diamino-2,3-dicyano-1,4-bis(phenylthio)butadiene (CHEBI:75389) is a enamine (CHEBI:47989) |
| IUPAC Name |
|---|
| (2Z,3Z)-bis[amino(phenylsulfanyl)methylidene]butanedinitrile |
| Synonym | Source |
|---|---|
| U0125 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8073563 | Reaxys |
| Citations |
|---|