EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16N2O2 |
| Net Charge | 0 |
| Average Mass | 292.338 |
| Monoisotopic Mass | 292.12118 |
| SMILES | Cc1ccc2c(c1)C(=O)[C@@]1(O)CCN(c3ccccc3)C1=N2 |
| InChI | InChI=1S/C18H16N2O2/c1-12-7-8-15-14(11-12)16(21)18(22)9-10-20(17(18)19-15)13-5-3-2-4-6-13/h2-8,11,22H,9-10H2,1H3/t18-/m0/s1 |
| InChIKey | LZAXPYOBKSJSEX-SFHVURJKSA-N |
| Roles Classification |
|---|
| Biological Role: | inhibitor A substance that diminishes the rate of a chemical reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-blebbistatin (CHEBI:75387) is a blebbistatin (CHEBI:75379) |
| (R)-blebbistatin (CHEBI:75387) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| (3aR)-3a-hydroxy-6-methyl-1-phenyl-1,2,3,3a-tetrahydro-4H-pyrrolo[2,3-b]quinolin-4-one |
| Synonym | Source |
|---|---|
| (R)-(+)-blebbistatin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10018193 | Reaxys |