EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11N5 |
| Net Charge | 0 |
| Average Mass | 177.211 |
| Monoisotopic Mass | 177.10145 |
| SMILES | N=C(N)NC(=N)Nc1ccccc1 |
| InChI | InChI=1S/C8H11N5/c9-7(10)13-8(11)12-6-4-2-1-3-5-6/h1-5H,(H6,9,10,11,12,13) |
| InChIKey | CUQCMXFWIMOWRP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | central nervous system drug A class of drugs producing both physiological and psychological effects through a variety of mechanisms involving the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenyl biguanide (CHEBI:75377) has functional parent biguanide (CHEBI:3095) |
| phenyl biguanide (CHEBI:75377) has role central nervous system drug (CHEBI:35470) |
| phenyl biguanide (CHEBI:75377) is a guanidines (CHEBI:24436) |
| IUPAC Name |
|---|
| N-phenylimidodicarbonimidic diamide |
| Synonyms | Source |
|---|---|
| 1-phenylbiguanide | ChEBI |
| N-phenylbiguanide | ChEBI |
| N-phenyl-N'-guanylguanidine | ChEBI |
| PBG | ChEBI |
| phenyl diguanide | ChEBI |
| Citations |
|---|