EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17N3 |
| Net Charge | 0 |
| Average Mass | 287.366 |
| Monoisotopic Mass | 287.14225 |
| SMILES | N=C1C=CC(=C(c2ccc(N)cc2)c2ccc(N)cc2)C=C1 |
| InChI | InChI=1S/C19H17N3/c20-16-7-1-13(2-8-16)19(14-3-9-17(21)10-4-14)15-5-11-18(22)12-6-15/h1-12,20H,21-22H2 |
| InChIKey | AFAIELJLZYUNPW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pararosaniline free base (CHEBI:75372) has role fluorochrome (CHEBI:51217) |
| pararosaniline free base (CHEBI:75372) has role histological dye (CHEBI:77178) |
| pararosaniline free base (CHEBI:75372) is a imine (CHEBI:24783) |
| pararosaniline free base (CHEBI:75372) is a substituted aniline (CHEBI:48975) |
| pararosaniline free base (CHEBI:75372) is conjugate base of pararosaniline(1+) (CHEBI:87664) |
| Incoming Relation(s) |
| pararosaniline(1+) (CHEBI:87664) is conjugate acid of pararosaniline free base (CHEBI:75372) |
| IUPAC Name |
|---|
| 4,4'-[(4-iminocyclohexa-2,5-dien-1-ylidene)methanediyl]dianiline |
| Synonyms | Source |
|---|---|
| 4-(4,4'-diamino-benzhydrylidene)-cyclohexa-2,5-dienone-imine | ChEBI |
| basic fuchsin | ChEBI |
| Basic Red 9 | ChemIDplus |
| pararosaniline | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Pararosaniline | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2126685 | Reaxys |
| CAS:479-73-2 | ChemIDplus |