EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13NO2 |
| Net Charge | 0 |
| Average Mass | 179.219 |
| Monoisotopic Mass | 179.09463 |
| SMILES | Cc1cc(C)cc(NCC(=O)O)c1 |
| InChI | InChI=1S/C10H13NO2/c1-7-3-8(2)5-9(4-7)11-6-10(12)13/h3-5,11H,6H2,1-2H3,(H,12,13) |
| InChIKey | YRNPDKYKAVLYOA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(3,5-dimethylphenyl)glycine (CHEBI:75365) is a glycine derivative (CHEBI:24373) |
| N-(3,5-dimethylphenyl)glycine (CHEBI:75365) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Incoming Relation(s) |
| N-(2,6-dimethylphenyl)-N2-(3,5-dimethylphenyl)glycinamide (CHEBI:75364) has functional parent N-(3,5-dimethylphenyl)glycine (CHEBI:75365) |
| IUPAC Name |
|---|
| N-(3,5-dimethylphenyl)glycine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2967444 | Reaxys |