EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:75335 - 4-nitroanthranilic acid
| Formula | C7H6N2O4 |
| Net Charge | 0 |
| Average Mass | 182.135 |
| Monoisotopic Mass | 182.03276 |
| SMILES | Nc1cc([N+](=O)[O-])ccc1C(=O)O |
| InChI | InChI=1S/C7H6N2O4/c8-6-3-4(9(12)13)1-2-5(6)7(10)11/h1-3H,8H2,(H,10,11) |
| InChIKey | UEALKTCRMBVTFN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-nitroanthranilic acid (CHEBI:75335) has functional parent anthranilic acid (CHEBI:30754) |
| 4-nitroanthranilic acid (CHEBI:75335) has role mutagen (CHEBI:25435) |
| 4-nitroanthranilic acid (CHEBI:75335) is a aminobenzoic acid (CHEBI:22495) |
| 4-nitroanthranilic acid (CHEBI:75335) is a nitrobenzoic acid (CHEBI:25553) |
| Incoming Relation(s) |
| 2-(benzoylamino)-4-nitrobenzoic acid (CHEBI:75334) has functional parent 4-nitroanthranilic acid (CHEBI:75335) |
| IUPAC Name |
|---|
| 2-amino-4-nitrobenzoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:785071 | Reaxys |
| CAS:619-17-0 | ChemIDplus |
| Citations |
|---|