EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29O3 |
| Net Charge | -1 |
| Average Mass | 317.449 |
| Monoisotopic Mass | 317.21222 |
| SMILES | CCCCC/C=C\C/C=C\C=C\C(=O)C/C=C\CCCC(=O)[O-] |
| InChI | InChI=1S/C20H30O3/c1-2-3-4-5-6-7-8-9-10-13-16-19(21)17-14-11-12-15-18-20(22)23/h6-7,9-11,13-14,16H,2-5,8,12,15,17-18H2,1H3,(H,22,23)/p-1/b7-6-,10-9-,14-11-,16-13+ |
| InChIKey | ULAXHDZCBOQYGV-HEJOTXCHSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-oxo-ETE(1−) (CHEBI:75326) is a long-chain fatty acid anion (CHEBI:57560) |
| 8-oxo-ETE(1−) (CHEBI:75326) is a oxo fatty acid anion (CHEBI:59836) |
| 8-oxo-ETE(1−) (CHEBI:75326) is a oxo-ETE anion (CHEBI:131859) |
| 8-oxo-ETE(1−) (CHEBI:75326) is a polyunsaturated fatty acid anion (CHEBI:76567) |
| 8-oxo-ETE(1−) (CHEBI:75326) is conjugate base of 8-oxo-ETE (CHEBI:75819) |
| Incoming Relation(s) |
| 8-oxo-ETE (CHEBI:75819) is conjugate acid of 8-oxo-ETE(1−) (CHEBI:75326) |
| IUPAC Name |
|---|
| (5Z,9E,11Z,14Z)-8-oxoicosa-5,9,11,14-tetraenoate |
| Synonyms | Source |
|---|---|
| 8-KETE(1−) | ChEBI |
| 8-keto-ETE(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 8-oxo-(5Z,9E,11Z,14Z)-eicosatetraenoate | UniProt |
| Citations |
|---|