EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:75323 - lactitol
| Formula | C12H24O11 |
| Net Charge | 0 |
| Average Mass | 344.313 |
| Monoisotopic Mass | 344.13186 |
| SMILES | OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)[C@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/2,2,1/[h2122h][a2112h-1b_1-5]/1-2/a4-b1 |
| InChI | InChI=1S/C12H24O11/c13-1-4(16)7(18)11(5(17)2-14)23-12-10(21)9(20)8(19)6(3-15)22-12/h4-21H,1-3H2/t4-,5+,6+,7+,8-,9-,10+,11+,12-/m0/s1 |
| InChIKey | VQHSOMBJVWLPSR-JVCRWLNRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | cathartic Any substance that accelerates defecation. Compare with laxatives, which are substances that ease defecation (usually by softening faeces). A substance can be both a laxative and a cathartic. |
| Applications: | laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. excipient A generally pharmacologically inactive substance that is formulated with the active ingredient of a medication. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lactitol (CHEBI:75323) has role cathartic (CHEBI:75325) |
| lactitol (CHEBI:75323) has role excipient (CHEBI:75324) |
| lactitol (CHEBI:75323) has role laxative (CHEBI:50503) |
| lactitol (CHEBI:75323) is a glycosyl alditol (CHEBI:36307) |
| Incoming Relation(s) |
| β-D-GlcpNAc-(1→3)-β-D-Galp-(1→4)-D-Glc-OH (CHEBI:147919) has functional parent lactitol (CHEBI:75323) |
| IUPAC Name |
|---|
| 4-O-β-D-galactopyranosyl-D-glucitol |
| INNs | Source |
|---|---|
| lactitol | ChemIDplus |
| lactitol | WHO MedNet |
| lactitol | WHO MedNet |
| lactitolum | ChemIDplus |
| Synonym | Source |
|---|---|
| D-lactitol | ChEBI |
| Brand Name | Source |
|---|---|
| Importal | KEGG DRUG |
| Citations |
|---|