EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22N4O3 |
| Net Charge | 0 |
| Average Mass | 318.377 |
| Monoisotopic Mass | 318.16919 |
| SMILES | CCCc1c(OCCCCc2nnnn2)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C16H22N4O3/c1-3-6-13-14(9-8-12(11(2)21)16(13)22)23-10-5-4-7-15-17-19-20-18-15/h8-9,22H,3-7,10H2,1-2H3,(H,17,18,19,20) |
| InChIKey | MWYHLEQJTQJHSS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | leukotriene antagonist A drug designed to prevent leukotriene synthesis or activity by blocking binding at the receptor level. |
| Applications: | anti-asthmatic drug A drug used to treat asthma. leukotriene antagonist A drug designed to prevent leukotriene synthesis or activity by blocking binding at the receptor level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tomelukast (CHEBI:75310) has role anti-asthmatic drug (CHEBI:49167) |
| tomelukast (CHEBI:75310) has role leukotriene antagonist (CHEBI:49159) |
| tomelukast (CHEBI:75310) is a acetophenones (CHEBI:22187) |
| tomelukast (CHEBI:75310) is a aromatic ether (CHEBI:35618) |
| tomelukast (CHEBI:75310) is a phenols (CHEBI:33853) |
| tomelukast (CHEBI:75310) is a tetrazoles (CHEBI:35689) |
| IUPAC Name |
|---|
| 1-{2-hydroxy-3-propyl-4-[4-(1H-tetrazol-5-yl)butoxy]phenyl}ethanone |
| INNs | Source |
|---|---|
| tomelukast | ChemIDplus |
| tomelukast | WHO MedNet |
| tomélukast | WHO MedNet |
| tomelukastum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2'-hydroxy-3'-propyl-4'-(4-(1H-tetrazol-5-yl)butoxy)acetophenone | ChemIDplus |
| LY171883 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4238438 | Reaxys |
| CAS:88107-10-2 | ChemIDplus |
| Citations |
|---|