EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17FN2O3 |
| Net Charge | 0 |
| Average Mass | 316.332 |
| Monoisotopic Mass | 316.12232 |
| SMILES | CC(/C=C/c1cccc(Oc2ccc(F)cc2)c1)N(O)C(N)=O |
| InChI | InChI=1S/C17H17FN2O3/c1-12(20(22)17(19)21)5-6-13-3-2-4-16(11-13)23-15-9-7-14(18)8-10-15/h2-12,22H,1H3,(H2,19,21)/b6-5+ |
| InChIKey | UAIYNMRLUHHRMF-AATRIKPKSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor A lipoxygenase inhibitor that interferes with the action of arachidonate 5-lipoxygenase (EC 1.13.11.34). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BW B70C (CHEBI:75307) has role EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor (CHEBI:64964) |
| BW B70C (CHEBI:75307) is a aromatic ether (CHEBI:35618) |
| BW B70C (CHEBI:75307) is a hydroxamic acid (CHEBI:24650) |
| BW B70C (CHEBI:75307) is a organofluorine compound (CHEBI:37143) |
| BW B70C (CHEBI:75307) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| 1-{(3E)-4-[3-(4-fluorophenoxy)phenyl]but-3-en-2-yl}-1-hydroxyurea |
| Synonyms | Source |
|---|---|
| 70C | ChemIDplus |
| BW-B70C | ChEBI |
| (E)-N-(3-(3-(4-Fluorophenoxy)phenyl)-1-(R,S)-methylprop-2-enyl)-N-hydroxyurea | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8853259 | Reaxys |
| CAS:134470-38-5 | ChemIDplus |
| Citations |
|---|