EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21NO |
| Net Charge | 0 |
| Average Mass | 243.350 |
| Monoisotopic Mass | 243.16231 |
| SMILES | CCCCCCCc1cc(O)c2ccccc2n1 |
| InChI | InChI=1S/C16H21NO/c1-2-3-4-5-6-9-13-12-16(18)14-10-7-8-11-15(14)17-13/h7-8,10-12H,2-6,9H2,1H3,(H,17,18) |
| InChIKey | UYRHHBXYXSYGHA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. signalling molecule A molecular messenger in which the molecule is specifically involved in transmitting information between cells. Such molecules are released from the cell sending the signal, cross over the gap between cells by diffusion, and interact with specific receptors in another cell, triggering a response in that cell by activating a series of enzyme controlled reactions which lead to changes inside the cell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-heptyl-4-hydroxyquinoline (CHEBI:75306) has role antibacterial agent (CHEBI:33282) |
| 2-heptyl-4-hydroxyquinoline (CHEBI:75306) has role iron chelator (CHEBI:38157) |
| 2-heptyl-4-hydroxyquinoline (CHEBI:75306) has role metabolite (CHEBI:25212) |
| 2-heptyl-4-hydroxyquinoline (CHEBI:75306) has role signalling molecule (CHEBI:62488) |
| 2-heptyl-4-hydroxyquinoline (CHEBI:75306) is a monohydroxyquinoline (CHEBI:38775) |
| 2-heptyl-4-hydroxyquinoline (CHEBI:75306) is tautomer of 2-heptyl-4-quinolone (CHEBI:62219) |
| Incoming Relation(s) |
| 2-heptyl-4-quinolone (CHEBI:62219) is tautomer of 2-heptyl-4-hydroxyquinoline (CHEBI:75306) |
| IUPAC Name |
|---|
| 2-heptylquinolin-4-ol |
| Synonyms | Source |
|---|---|
| 4-hydroxy-2-heptylquinoline | ChEBI |
| HHQ | ChEBI |
| MY-12-62c | ChemIDplus |
| pseudan VII | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-heptyl-4-hydroxyquinoline | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:159724 | Reaxys |
| CAS:2503-80-2 | ChemIDplus |
| Citations |
|---|