EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H32NO10 |
| Net Charge | +1 |
| Average Mass | 530.550 |
| Monoisotopic Mass | 530.20207 |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(C)O)C[C@@H]3O[C@H]1C[C@H]([NH3+])[C@H](O)[C@H](C)O1 |
| InChI | InChI=1S/C27H31NO10/c1-10-22(30)14(28)7-17(37-10)38-16-9-27(35,11(2)29)8-13-19(16)26(34)21-20(24(13)32)23(31)12-5-4-6-15(36-3)18(12)25(21)33/h4-6,10-11,14,16-17,22,29-30,32,34-35H,7-9,28H2,1-3H3/p+1/t10-,11?,14-,16-,17-,22+,27-/m0/s1 |
| InChIKey | HJEZFVLKJYFNQW-FKKRWUELSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13-dihydrodaunorubicin(1+) (CHEBI:75296) is a ammonium ion derivative (CHEBI:35274) |
| 13-dihydrodaunorubicin(1+) (CHEBI:75296) is a organic cation (CHEBI:25697) |
| 13-dihydrodaunorubicin(1+) (CHEBI:75296) is conjugate acid of 13-dihydrodaunorubicin (CHEBI:31059) |
| Incoming Relation(s) |
| 13-dihydrodaunorubicin (CHEBI:31059) is conjugate base of 13-dihydrodaunorubicin(1+) (CHEBI:75296) |
| IUPAC Name |
|---|
| (1S,3S)-3,5,12-trihydroxy-3-(1-hydroxyethyl)-10-methoxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-1-yl 3-azaniumyl-2,3,6-trideoxy-α-L-lyxo-hexopyranoside |
| UniProt Name | Source |
|---|---|
| 13-dihydrodaunorubicin | UniProt |
| Citations |
|---|