EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H25FN4O2 |
| Net Charge | 0 |
| Average Mass | 420.488 |
| Monoisotopic Mass | 420.19615 |
| SMILES | [H][C@@]1(COc2ccc(F)cn2)CC[C@@]([H])(C)N(C(=O)c2cc(C)ccc2-c2ncccn2)C1 |
| InChI | InChI=1S/C24H25FN4O2/c1-16-4-8-20(23-26-10-3-11-27-23)21(12-16)24(30)29-14-18(6-5-17(29)2)15-31-22-9-7-19(25)13-28-22/h3-4,7-13,17-18H,5-6,14-15H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | NPFDWHQSDBWQLH-QZTJIDSGSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| filorexant (CHEBI:752882) has role antidepressant (CHEBI:35469) |
| filorexant (CHEBI:752882) is a N-acylpiperidine (CHEBI:48591) |
| INN | Source |
|---|---|
| filorexant | WHO MedNet |
| Synonym | Source |
|---|---|
| MK-6096 | ChEMBL |
| Citations |
|---|