EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H25NO2 |
| Net Charge | 0 |
| Average Mass | 263.381 |
| Monoisotopic Mass | 263.18853 |
| SMILES | [H][C@@](O)(CCN)c1cccc(OCC2CCCCC2)c1 |
| InChI | InChI=1S/C16H25NO2/c17-10-9-16(18)14-7-4-8-15(11-14)19-12-13-5-2-1-3-6-13/h4,7-8,11,13,16,18H,1-3,5-6,9-10,12,17H2/t16-/m1/s1 |
| InChIKey | WJIGGYYSZBWCGC-MRXNPFEDSA-N |
| Roles Classification |
|---|
| Application: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| emixustat (CHEBI:752881) has role ophthalmology drug (CHEBI:66981) |
| emixustat (CHEBI:752881) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| emixustat | WHO MedNet |
| Synonym | Source |
|---|---|
| ACU-4429 | ChEMBL |