EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H11NO2.C23H34O5 |
| Net Charge | 0 |
| Average Mass | 495.657 |
| Monoisotopic Mass | 495.31960 |
| SMILES | OCCNCCO.[H][C@](O)(CCCCC)CC[C@]1([H])[C@@]2([H])Cc3cccc(OCC(=O)O)c3C[C@@]2([H])C[C@@]1([H])O |
| InChI | InChI=1S/C23H34O5.C4H11NO2/c1-2-3-4-7-17(24)9-10-18-19-11-15-6-5-8-22(28-14-23(26)27)20(15)12-16(19)13-21(18)25;6-3-1-5-2-4-7/h5-6,8,16-19,21,24-25H,2-4,7,9-14H2,1H3,(H,26,27);5-7H,1-4H2/t16-,17-,18+,19-,21+;/m0./s1 |
| InChIKey | RHWRWEUCEXUUAV-ZSESPEEFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| treprostinil diolamine (CHEBI:752880) has role antihypertensive agent (CHEBI:35674) |
| treprostinil diolamine (CHEBI:752880) is a monocarboxylic acid (CHEBI:25384) |
| Synonyms | Source |
|---|---|
| Treprostinil diethanolamine | ChEMBL |
| Treprostinil diolamin | ChEMBL |
| UT-15C | ChEMBL |
| Brand Name | Source |
|---|---|
| Orenitram | ChEMBL |