EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20FN5O4 |
| Net Charge | 0 |
| Average Mass | 401.398 |
| Monoisotopic Mass | 401.14993 |
| SMILES | CO/N=C1\CN(c2nc3c(cc2F)c(=O)c(C(=O)O)cn3C2CC2)CC12CNC2 |
| InChI | InChI=1S/C19H20FN5O4/c1-29-23-14-6-24(9-19(14)7-21-8-19)17-13(20)4-11-15(26)12(18(27)28)5-25(10-2-3-10)16(11)22-17/h4-5,10,21H,2-3,6-9H2,1H3,(H,27,28)/b23-14+ |
| InChIKey | ZNPOCLHDJCAZAH-OEAKJJBVSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zabofloxacin (CHEBI:752878) has role antimicrobial agent (CHEBI:33281) |
| zabofloxacin (CHEBI:752878) is a organofluorine compound (CHEBI:37143) |
| zabofloxacin (CHEBI:752878) is a quinolone (CHEBI:23765) |
| INNs | Source |
|---|---|
| zabofloxacin | WHO MedNet |
| zabofloxacine | WHO MedNet |
| zabofloxacino | WHO MedNet |