EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:752874 - cilansetron hydrochloride
| Formula | HCl.C20H21N3O |
| Net Charge | 0 |
| Average Mass | 355.869 |
| Monoisotopic Mass | 355.14514 |
| SMILES | Cc1nccn1C[C@H]1CCc2c(c3cccc4c3n2CCC4)C1=O.Cl |
| InChI | InChI=1S/C20H21N3O.ClH/c1-13-21-9-11-22(13)12-15-7-8-17-18(20(15)24)16-6-2-4-14-5-3-10-23(17)19(14)16;/h2,4,6,9,11,15H,3,5,7-8,10,12H2,1H3;1H/t15-;/m1./s1 |
| InChIKey | PGMSXNFJFNKUGN-XFULWGLBSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cilansetron hydrochloride (CHEBI:752874) is a carbazoles (CHEBI:48513) |
| Synonyms | Source |
|---|---|
| Calmactin | ChEMBL |
| Cilansetron hcl | ChEMBL |
| Cilansetron hydrochloride | ChEMBL |
| Cilansetron hydrochloride monohydrate | ChEMBL |
| DU-123265 | ChEMBL |
| DU123265 | ChEMBL |