EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:752871 - rimeporide
| Formula | C11H15N3O5S2 |
| Net Charge | 0 |
| Average Mass | 333.391 |
| Monoisotopic Mass | 333.04531 |
| SMILES | Cc1cc(S(C)(=O)=O)c(S(C)(=O)=O)cc1C(=O)NC(=N)N |
| InChI | InChI=1S/C11H15N3O5S2/c1-6-4-8(20(2,16)17)9(21(3,18)19)5-7(6)10(15)14-11(12)13/h4-5H,1-3H3,(H4,12,13,14,15) |
| InChIKey | GROMEQPXDKRRIE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rimeporide (CHEBI:752871) is a benzoic acids (CHEBI:22723) |
| INNs | Source |
|---|---|
| rimeporida | WHO MedNet |
| rimeporide | WHO MedNet |
| Citations |
|---|