EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22ClN2O3 |
| Net Charge | 0 |
| Average Mass | 367.839 |
| Monoisotopic Mass | 367.13283 |
| SMILES | CC(C)(C)n1ncc(OCc2ccc(COCC[18F])cc2)c(Cl)c1=O |
| InChI | InChI=1S/C18H22ClFN2O3/c1-18(2,3)22-17(23)16(19)15(10-21-22)25-12-14-6-4-13(5-7-14)11-24-9-8-20/h4-7,10H,8-9,11-12H2,1-3H3/i20-1 |
| InChIKey | RMXZKEPDYBTFOS-LRFGSCOBSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flurpiridaz f 18 (CHEBI:752868) has role cardiovascular drug (CHEBI:35554) |
| flurpiridaz f 18 (CHEBI:752868) is a benzyl ether (CHEBI:59859) |
| INN | Source |
|---|---|
| flurpiridaz (18f) | WHO MedNet |
| Synonyms | Source |
|---|---|
| Bms-747158 | ChEMBL |
| BMS 747158-02 | ChEMBL |
| BMS-747158-02 | ChEMBL |
| Flurpiridaz f 18 | ChEMBL |
| Flurpiridaz f-18 | ChEMBL |
| Flurpiridaz, f-18 | ChEMBL |
| Citations |
|---|