EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H60FN3O13 |
| Net Charge | 0 |
| Average Mass | 881.992 |
| Monoisotopic Mass | 881.41102 |
| SMILES | [H][C@@]12O[C@H](CN(C)C)O[C@]1([H])C1=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)c3ncccc3F)C[C@@](O)([C@@H](OC(=O)c3ccccc3)[C@@]3([H])[C@@]2(C)CC[C@@]2([H])OC[C@@]32OC(C)=O)C1(C)C |
| InChI | InChI=1S/C46H60FN3O13/c1-24-28(58-40(54)34(52)33(32-27(47)17-14-20-48-32)49-41(55)63-42(3,4)5)21-46(56)38(61-39(53)26-15-12-11-13-16-26)36-44(8,19-18-29-45(36,23-57-29)62-25(2)51)37-35(31(24)43(46,6)7)59-30(60-37)22-50(9)10/h11-17,20,28-30,33-38,52,56H,18-19,21-23H2,1-10H3,(H,49,55)/t28-,29+,30+,33-,34+,35+,36-,37+,38-,44+,45-,46+/m0/s1 |
| InChIKey | MODVSQKJJIBWPZ-VLLPJHQWSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tesetaxel (CHEBI:752861) has role antineoplastic agent (CHEBI:35610) |
| tesetaxel (CHEBI:752861) is a benzoate ester (CHEBI:36054) |
| INN | Source |
|---|---|
| tesetaxel | WHO MedNet |
| Citations |
|---|