EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16O6S |
| Net Charge | 0 |
| Average Mass | 324.354 |
| Monoisotopic Mass | 324.06676 |
| SMILES | Cc1cc(=O)oc2cc(O[C@@H]3SC[C@@H](O)[C@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C15H16O6S/c1-7-4-12(17)21-11-5-8(2-3-9(7)11)20-15-14(19)13(18)10(16)6-22-15/h2-5,10,13-16,18-19H,6H2,1H3/t10-,13+,14-,15-/m1/s1 |
| InChIKey | JRHNIQQUVJOPQC-AQNFWKISSA-N |
| Roles Classification |
|---|
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| odiparcil (CHEBI:752847) has role anti-arrhythmia drug (CHEBI:38070) |
| odiparcil (CHEBI:752847) is a coumarins (CHEBI:23403) |
| INNs | Source |
|---|---|
| odiparcil | WHO MedNet |
| odiparcilo | WHO MedNet |