EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H21N5O5S |
| Net Charge | 0 |
| Average Mass | 491.529 |
| Monoisotopic Mass | 491.12634 |
| SMILES | COc1ccccc1Oc1c(NS(=O)(=O)/C=C/c2ccccc2)nc(-c2ncccn2)nc1OC |
| InChI | InChI=1S/C24H21N5O5S/c1-32-18-11-6-7-12-19(18)34-20-21(29-35(30,31)16-13-17-9-4-3-5-10-17)27-23(28-24(20)33-2)22-25-14-8-15-26-22/h3-16H,1-2H3,(H,27,28,29)/b16-13+ |
| InChIKey | LONWRQOYFPYMQD-DTQAZKPQSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nebentan (CHEBI:752844) has role antineoplastic agent (CHEBI:35610) |
| nebentan (CHEBI:752844) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| nebentan | WHO MedNet |
| Synonyms | Source |
|---|---|
| HE-11 | ChEMBL |
| Nebentan potassium | ChEMBL |
| Ym598 | ChEMBL |
| YM-598 | ChEMBL |