EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10F3N3O2 |
| Net Charge | 0 |
| Average Mass | 309.247 |
| Monoisotopic Mass | 309.07251 |
| SMILES | N#CCC/C(O)=C(\C#N)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H10F3N3O2/c15-14(16,17)9-3-5-10(6-4-9)20-13(22)11(8-19)12(21)2-1-7-18/h3-6,21H,1-2H2,(H,20,22)/b12-11- |
| InChIKey | OQUXVPJVBSENGK-QXMHVHEDSA-N |
| Roles Classification |
|---|
| Application: | renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| manitimus (CHEBI:752841) has role renoprotective agent (CHEBI:231911) |
| manitimus (CHEBI:752841) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| INN | Source |
|---|---|
| manitimus | WHO MedNet |
| Synonyms | Source |
|---|---|
| FK-778 | ChEMBL |
| FK778 | ChEMBL |
| HMR 1715 | ChEMBL |
| HMR-1715 | ChEMBL |
| HMR1715 | ChEMBL |
| MNA-715 | ChEMBL |