EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C19H23NO3 |
| Net Charge | 0 |
| Average Mass | 349.858 |
| Monoisotopic Mass | 349.14447 |
| SMILES | Cl.[H][C@@]12C=C[C@H](O)[C@]3([H])Oc4c(OCC)ccc5c4[C@]13CCN(C)[C@]2([H])C5 |
| InChI | InChI=1S/C19H23NO3.ClH/c1-3-22-15-7-4-11-10-13-12-5-6-14(21)18-19(12,8-9-20(13)2)16(11)17(15)23-18;/h4-7,12-14,18,21H,3,8-10H2,1-2H3;1H/t12-,13+,14-,18-,19-;/m0./s1 |
| InChIKey | ZPPBASOODYCKDP-YZZSNFJZSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethylmorphine hydrochloride (CHEBI:752808) is a morphinane alkaloid (CHEBI:25418) |
| Synonyms | Source |
|---|---|
| Codethyline hydrochloride | ChEMBL |
| Ethylmorphine hcl | ChEMBL |
| Ethylmorphine hydrochloride | ChEMBL |
| Ethylmorphine hydrochloride anhydrous | ChEMBL |