EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H41N5O7 |
| Net Charge | 0 |
| Average Mass | 475.587 |
| Monoisotopic Mass | 475.30060 |
| SMILES | CCN[C@@H]1C[C@H](N)[C@@H](O[C@H]2OC(CN)=CC[C@H]2N)[C@H](O)[C@H]1O[C@H]1OC[C@H](O)[C@@H](NC)[C@@]1(C)O |
| InChI | InChI=1S/C21H41N5O7/c1-4-26-13-7-12(24)16(32-19-11(23)6-5-10(8-22)31-19)15(28)17(13)33-20-21(2,29)18(25-3)14(27)9-30-20/h5,11-20,25-29H,4,6-9,22-24H2,1-3H3/t11-,12+,13-,14+,15+,16-,17+,18-,19-,20-,21-/m1/s1 |
| InChIKey | ZBGPYVZLYBDXKO-HILBYHGXSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| netilmycin (CHEBI:7528) has functional parent streptamine (CHEBI:27955) |
| netilmycin (CHEBI:7528) is a amino cyclitol glycoside (CHEBI:22479) |
| netilmycin (CHEBI:7528) is a aminoglycoside antibiotic (CHEBI:22507) |
| netilmycin (CHEBI:7528) is a monosaccharide derivative (CHEBI:63367) |
| netilmycin (CHEBI:7528) is a β-L-arabinoside (CHEBI:28079) |
| Incoming Relation(s) |
| netilmicin sulfate (CHEBI:7529) has functional parent netilmycin (CHEBI:7528) |
| IUPAC Name |
|---|
| (1S,2S,3R,4S,6R)-4-amino-3-[(2S,3R)-3-amino-6-(aminomethyl)-3,4-dihydro-2H-pyran-2-yloxy]-6-(ethylamino)-2-hydroxycyclohexyl 3-deoxy-4-C-methyl-3-(methylamino)-β-L-arabinopyranoside |
| Synonyms | Source |
|---|---|
| 1-N-Ethylsisomicin | ChemIDplus |
| Netilmicin | KEGG COMPOUND |
| O-3-Deoxy-4-C-methyl-3-(methylamino)-beta-L-arabinopyranosyl-(1-6)-O-(2,6-diamino-2,3,4,6-tetradeoxy-alpha-D-glycero-hex-4-enopyranosyl-(1-4))-2-deoxy-N(1)-ethyl-D-streptamine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:56391-56-1 | KEGG COMPOUND |
| CAS:56391-56-1 | ChemIDplus |