EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O2 |
| Net Charge | 0 |
| Average Mass | 330.512 |
| Monoisotopic Mass | 330.25588 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@](O)(CCC)CC[C@@]21[H] |
| InChI | InChI=1S/C22H34O2/c1-4-10-22(24)13-9-19-17-6-5-15-14-16(23)7-11-20(15,2)18(17)8-12-21(19,22)3/h14,17-19,24H,4-13H2,1-3H3/t17-,18+,19+,20+,21+,22+/m1/s1 |
| InChIKey | LZSOOHLAZHOTHJ-GUCLMQHLSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| topterone (CHEBI:752782) has role androgen (CHEBI:50113) |
| topterone (CHEBI:752782) is a 3-hydroxy steroid (CHEBI:36834) |
| INNs | Source |
|---|---|
| topterona | WHO MedNet |
| topterone | WHO MedNet |
| Synonyms | Source |
|---|---|
| WIN 17665 | ChEMBL |
| WIN-17665 | ChEMBL |