EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18O2S |
| Net Charge | 0 |
| Average Mass | 286.396 |
| Monoisotopic Mass | 286.10275 |
| SMILES | C/C(=C\c1ccc(C(=O)O)cc1)c1ccc(C(C)C)s1 |
| InChI | InChI=1S/C17H18O2S/c1-11(2)15-8-9-16(20-15)12(3)10-13-4-6-14(7-5-13)17(18)19/h4-11H,1-3H3,(H,18,19)/b12-10+ |
| InChIKey | GDDUESKGWJTHLR-ZRDIBKRKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| namirotene (CHEBI:752770) is a benzoic acids (CHEBI:22723) |
| INNs | Source |
|---|---|
| namirotene | WHO MedNet |
| namiroteno | WHO MedNet |