EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H29O4S.Na |
| Net Charge | 0 |
| Average Mass | 316.439 |
| Monoisotopic Mass | 316.16842 |
| SMILES | CCCCC(CC)CCC(CC(C)C)OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C14H30O4S.Na/c1-5-7-8-13(6-2)9-10-14(11-12(3)4)18-19(15,16)17;/h12-14H,5-11H2,1-4H3,(H,15,16,17);/q;+1/p-1 |
| InChIKey | FVEFRICMTUKAML-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Role: | detergent A surfactant (or a mixture containing one or more surfactants) having cleaning properties in dilute solutions. |
| Biological Role: | sclerotherapy agent A sclerotherapy agent is used to treat blood vessels or blood vessel malformations (vascular malformations) and also those of the lymphatic system by injection into the vessels, which makes them shrink. |
| Application: | detergent A surfactant (or a mixture containing one or more surfactants) having cleaning properties in dilute solutions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium tetradecyl sulfate (CHEBI:75273) has part tetradecyl sulfate (CHEBI:75274) |
| sodium tetradecyl sulfate (CHEBI:75273) has role detergent (CHEBI:27780) |
| sodium tetradecyl sulfate (CHEBI:75273) has role sclerotherapy agent (CHEBI:63923) |
| sodium tetradecyl sulfate (CHEBI:75273) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 7-ethyl-2-methylundecan-4-yl sulfate |
| INN | Source |
|---|---|
| sodium tetradecyl sulfate | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 7-Ethyl-2-methyl-4-undecanol sulfate sodium salt | ChemIDplus |
| Natrii tetradecylis sulfa | ChemIDplus |
| niaproof 4 | ChEBI |
| Sodium 2-methyl-7-ethylundecanol-4-sulfate | ChemIDplus |
| Sodium 7-ethyl-2-methyl-4-undecanol sulfate | ChemIDplus |
| Tetradecilsulfato sodico | ChemIDplus |
| Brand Name | Source |
|---|---|
| Sotradecol | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D06882 | KEGG DRUG |
| WO2006086837 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11322406 | Reaxys |
| CAS:139-88-8 | KEGG DRUG |
| Citations |
|---|